About [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium
[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium (PubChem CID 163575598) has the molecular formula C24H22N5O+
and a molecular weight of 396.47 g/mol. Its IUPAC name is [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium.
Molecular Properties
| Compound Name | [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium |
| PubChem CID | 163575598 |
| Molecular Formula | C24H22N5O+ |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium |
| SMILES | Nc1nc(C(=O)N2Cc3ccccc3C2)c2cc([NH2+]Cc3ccccc3)ccc2n1 |
| InChI | InChI=1S/C24H21N5O/c25-24-27-21-11-10-19(26-13-16-6-2-1-3-7-16)12-20(21)22(28-24)23(30)29-14-17-8-4-5-9-18(17)15-29/h1-12,26H,13-15H2,(H2,25,27,28)/p+1 |
| InChIKey | GDEOOWXZNSMOFX-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium?
The IUPAC name of [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium (CID 163575598) is [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium.
What is the SMILES notation for [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium?
The canonical SMILES for [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium is Nc1nc(C(=O)N2Cc3ccccc3C2)c2cc([NH2+]Cc3ccccc3)ccc2n1.
What is the InChIKey of [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium?
The InChIKey is GDEOOWXZNSMOFX-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H21N5O/c25-24-27-21-11-10-19(26-13-16-6-2-1-3-7-16)12-20(21)22(28-24)23(30)29-14-17-8-4-5-9-18(17)15-29/h1-12,26H,13-15H2,(H2,25,27,28)/p+1.
What are the key properties of [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium?
[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium has a molecular weight of 396.47 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl]-benzylazanium is sourced from PubChem (CID 163575598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).