C22H30O2S4 — CID 163575956
1-(2,2,6,6-tetramethyl-8-pentanoyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)pentan-1-one (PubChem CID 163575956) has the molecular formula C22H30O2S4 and a molecular weight of 454.75 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethyl-8-pentanoyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)pentan-1-one.
| Compound Name | 1-(2,2,6,6-tetramethyl-8-pentanoyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 163575956 |
| Molecular Formula | C22H30O2S4 |
| Molecular Weight | 454.75 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-(2,2,6,6-tetramethyl-8-pentanoyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)pentan-1-one |
| SMILES | CCCCC(=O)c1c2c(c(C(=O)CCCC)c3c1SC(C)(C)S3)SC(C)(C)S2 |
| InChI | InChI=1S/C22H30O2S4/c1-7-9-11-13(23)15-17-19(27-21(3,4)25-17)16(14(24)12-10-8-2)20-18(15)26-22(5,6)28-20/h7-12H2,1-6H3 |
| InChIKey | GDMCKYAUWQVWIF-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.75 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |