C15H18F3NO2S — CID 163577079
1-[(2'S,6'R)-2',6'-dimethylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone (PubChem CID 163577079) has the molecular formula C15H18F3NO2S and a molecular weight of 333.38 g/mol. Its IUPAC name is 1-[(2'S,6'R)-2',6'-dimethylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2'S,6'R)-2',6'-dimethylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 163577079 |
| Molecular Formula | C15H18F3NO2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-[(2'S,6'R)-2',6'-dimethylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
| SMILES | C[C@@H]1CC2(C[C@H](C)N1C(=O)C(F)(F)F)OCCc1ccsc12 |
| InChI | InChI=1S/C15H18F3NO2S/c1-9-7-14(12-11(3-5-21-14)4-6-22-12)8-10(2)19(9)13(20)15(16,17)18/h4,6,9-10H,3,5,7-8H2,1-2H3/t9-,10+,14? |
| InChIKey | GEKMBFAKUMGINL-XFLKPENQSA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |