About CID 163577333
CID 163577333 (PubChem CID 163577333) has the molecular formula C15H23NSi-
and a molecular weight of 245.44 g/mol.
Molecular Properties
| Compound Name | CID 163577333 |
| PubChem CID | 163577333 |
| Molecular Formula | C15H23NSi- |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | — |
| SMILES | C=Cc1cccc(C[Si-](C)(C)N2CCCC2)c1 |
| InChI | InChI=1S/C15H23NSi/c1-4-14-8-7-9-15(12-14)13-17(2,3)16-10-5-6-11-16/h4,7-9,12H,1,5-6,10-11,13H2,2-3H3/q-1 |
| InChIKey | IJNMMOQJOVJSCH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163577333 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163577333?
The IUPAC name of CID 163577333 (CID 163577333) is not available.
What is the SMILES notation for CID 163577333?
The canonical SMILES for CID 163577333 is C=Cc1cccc(C[Si-](C)(C)N2CCCC2)c1.
What is the InChIKey of CID 163577333?
The InChIKey is IJNMMOQJOVJSCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NSi/c1-4-14-8-7-9-15(12-14)13-17(2,3)16-10-5-6-11-16/h4,7-9,12H,1,5-6,10-11,13H2,2-3H3/q-1.
What are the key properties of CID 163577333?
CID 163577333 has a molecular weight of 245.44 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163577333 is sourced from PubChem (CID 163577333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).