About CID 163578418
CID 163578418 (PubChem CID 163578418) has the molecular formula C24H26N4O4
and a molecular weight of 434.50 g/mol.
Molecular Properties
| Compound Name | CID 163578418 |
| PubChem CID | 163578418 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | — |
| SMILES | COC1=CC(c2ccc3c(c2)C2(CC4(CCCOC4)O3)N=C(N)N(C)C2=O)CC(C#N)=C1 |
| InChI | InChI=1S/C24H26N4O4/c1-28-21(29)24(27-22(28)26)13-23(6-3-7-31-14-23)32-20-5-4-16(11-19(20)24)17-8-15(12-25)9-18(10-17)30-2/h4-5,9-11,17H,3,6-8,13-14H2,1-2H3,(H2,26,27) |
| InChIKey | GFMWASMTPMWOJO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 163578418 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163578418?
The IUPAC name of CID 163578418 (CID 163578418) is not available.
What is the SMILES notation for CID 163578418?
The canonical SMILES for CID 163578418 is COC1=CC(c2ccc3c(c2)C2(CC4(CCCOC4)O3)N=C(N)N(C)C2=O)CC(C#N)=C1.
What is the InChIKey of CID 163578418?
The InChIKey is GFMWASMTPMWOJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O4/c1-28-21(29)24(27-22(28)26)13-23(6-3-7-31-14-23)32-20-5-4-16(11-19(20)24)17-8-15(12-25)9-18(10-17)30-2/h4-5,9-11,17H,3,6-8,13-14H2,1-2H3,(H2,26,27).
What are the key properties of CID 163578418?
CID 163578418 has a molecular weight of 434.50 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163578418 is sourced from PubChem (CID 163578418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).