C14H16FIO4 — CID 163578784
[(2S,3R,4S)-4-fluoro-2-(iodomethyl)-2-methoxy-5-methyloxolan-3-yl] benzoate (PubChem CID 163578784) has the molecular formula C14H16FIO4 and a molecular weight of 394.18 g/mol. Its IUPAC name is [(2S,3R,4S)-4-fluoro-2-(iodomethyl)-2-methoxy-5-methyloxolan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S)-4-fluoro-2-(iodomethyl)-2-methoxy-5-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 163578784 |
| Molecular Formula | C14H16FIO4 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | [(2S,3R,4S)-4-fluoro-2-(iodomethyl)-2-methoxy-5-methyloxolan-3-yl] benzoate |
| SMILES | CO[C@]1(CI)OC(C)[C@H](F)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16FIO4/c1-9-11(15)12(14(8-16,18-2)20-9)19-13(17)10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3/t9?,11-,12-,14+/m0/s1 |
| InChIKey | GFTVLJXNBWHNFX-LJSAAOIKSA-N |
| XLogP | 2.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|