About 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol
2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol (PubChem CID 163579006) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol |
| PubChem CID | 163579006 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol |
| SMILES | CCOC1(O)CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C9H14N2O2S/c1-2-13-9(12)4-3-6-7(5-9)14-8(10)11-6/h12H,2-5H2,1H3,(H2,10,11) |
| InChIKey | GFYGLWRBHGAVCS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol?
The IUPAC name of 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol (CID 163579006) is 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol.
What is the SMILES notation for 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol?
The canonical SMILES for 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol is CCOC1(O)CCc2nc(N)sc2C1.
What is the InChIKey of 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol?
The InChIKey is GFYGLWRBHGAVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-2-13-9(12)4-3-6-7(5-9)14-8(10)11-6/h12H,2-5H2,1H3,(H2,10,11).
What are the key properties of 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol?
2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol has a molecular weight of 214.29 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-ethoxy-5,7-dihydro-4H-1,3-benzothiazol-6-ol is sourced from PubChem (CID 163579006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).