About 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile
5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile (PubChem CID 163579555) has the molecular formula C9H5NO
and a molecular weight of 143.14 g/mol. Its IUPAC name is 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile.
Molecular Properties
| Compound Name | 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile |
| PubChem CID | 163579555 |
| Molecular Formula | C9H5NO |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile |
| SMILES | N#CC1=CC=CC(C=O)C#C1 |
| InChI | InChI=1S/C9H5NO/c10-6-8-2-1-3-9(7-11)5-4-8/h1-3,7,9H |
| InChIKey | GGJAAQFEGOSGRC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile?
The IUPAC name of 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile (CID 163579555) is 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile.
What is the SMILES notation for 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile?
The canonical SMILES for 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile is N#CC1=CC=CC(C=O)C#C1.
What is the InChIKey of 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile?
The InChIKey is GGJAAQFEGOSGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO/c10-6-8-2-1-3-9(7-11)5-4-8/h1-3,7,9H.
What are the key properties of 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile?
5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile has a molecular weight of 143.14 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-formylcyclohepta-1,3-dien-6-yne-1-carbonitrile is sourced from PubChem (CID 163579555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).