C19H17F5O3S — CID 163579688
1-(4-fluorophenyl)sulfonyl-6-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 163579688) has the molecular formula C19H17F5O3S and a molecular weight of 420.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-6-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-6-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 163579688 |
| Molecular Formula | C19H17F5O3S |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-6-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | CC(F)(c1ccc2c(c1)CCC(O)C2S(=O)(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H17F5O3S/c1-18(21,19(22,23)24)12-3-8-15-11(10-12)2-9-16(25)17(15)28(26,27)14-6-4-13(20)5-7-14/h3-8,10,16-17,25H,2,9H2,1H3 |
| InChIKey | GGLXHHJVJOHGEZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |