C17H30N2O4S2 — CID 163579806
2-N-(1,4-dimethylcyclohepta-2,4,6-trien-1-yl)-4-N,2,4-trimethylpentane-2,4-disulfonamide (PubChem CID 163579806) has the molecular formula C17H30N2O4S2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2-N-(1,4-dimethylcyclohepta-2,4,6-trien-1-yl)-4-N,2,4-trimethylpentane-2,4-disulfonamide.
| Compound Name | 2-N-(1,4-dimethylcyclohepta-2,4,6-trien-1-yl)-4-N,2,4-trimethylpentane-2,4-disulfonamide |
|---|---|
| PubChem CID | 163579806 |
| Molecular Formula | C17H30N2O4S2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-N-(1,4-dimethylcyclohepta-2,4,6-trien-1-yl)-4-N,2,4-trimethylpentane-2,4-disulfonamide |
| SMILES | CNS(=O)(=O)C(C)(C)CC(C)(C)S(=O)(=O)NC1(C)C=CC=C(C)C=C1 |
| InChI | InChI=1S/C17H30N2O4S2/c1-14-9-8-11-17(6,12-10-14)19-25(22,23)16(4,5)13-15(2,3)24(20,21)18-7/h8-12,18-19H,13H2,1-7H3 |
| InChIKey | GGODYLLYCUXKGQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |