About N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine
N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine (PubChem CID 163579822) has the molecular formula C11H24IN
and a molecular weight of 297.22 g/mol. Its IUPAC name is N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine |
| PubChem CID | 163579822 |
| Molecular Formula | C11H24IN |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)(I)CC(C)(C)NC(C)(C)C |
| InChI | InChI=1S/C11H24IN/c1-9(2,3)13-11(6,7)8-10(4,5)12/h13H,8H2,1-7H3 |
| InChIKey | GGOQEDIQQUTVLV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine?
The IUPAC name of N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine (CID 163579822) is N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine.
What is the SMILES notation for N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine?
The canonical SMILES for N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine is CC(C)(I)CC(C)(C)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine?
The InChIKey is GGOQEDIQQUTVLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24IN/c1-9(2,3)13-11(6,7)8-10(4,5)12/h13H,8H2,1-7H3.
What are the key properties of N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine?
N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine has a molecular weight of 297.22 g/mol, XLogP of 3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4-iodo-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 163579822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).