C16H9ClO — CID 163580167
5-chloronaphtho[1,2-b][1]benzofuran (PubChem CID 163580167) has the molecular formula C16H9ClO and a molecular weight of 252.70 g/mol. Its IUPAC name is 5-chloronaphtho[1,2-b][1]benzofuran.
| Compound Name | 5-chloronaphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 163580167 |
| Molecular Formula | C16H9ClO |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 5-chloronaphtho[1,2-b][1]benzofuran |
| SMILES | Clc1cc2c3ccccc3oc2c2ccccc12 |
| InChI | InChI=1S/C16H9ClO/c17-14-9-13-11-6-3-4-8-15(11)18-16(13)12-7-2-1-5-10(12)14/h1-9H |
| InChIKey | GGWFBUAEQFQXKQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |