C17H22N2O3 — CID 163580636
4-hydroxy-1,6-dimethyl-N-[(2Z,4Z,6Z)-6-methylocta-2,4,6-trien-3-yl]-2-oxopyridine-3-carboxamide (PubChem CID 163580636) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-hydroxy-1,6-dimethyl-N-[(2Z,4Z,6Z)-6-methylocta-2,4,6-trien-3-yl]-2-oxopyridine-3-carboxamide.
| Compound Name | 4-hydroxy-1,6-dimethyl-N-[(2Z,4Z,6Z)-6-methylocta-2,4,6-trien-3-yl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 163580636 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-hydroxy-1,6-dimethyl-N-[(2Z,4Z,6Z)-6-methylocta-2,4,6-trien-3-yl]-2-oxopyridine-3-carboxamide |
| SMILES | C/C=C(C)\C=C/C(=C/C)NC(=O)c1c(O)cc(C)n(C)c1=O |
| InChI | InChI=1S/C17H22N2O3/c1-6-11(3)8-9-13(7-2)18-16(21)15-14(20)10-12(4)19(5)17(15)22/h6-10,20H,1-5H3,(H,18,21)/b9-8-,11-6-,13-7- |
| InChIKey | GHGJOIPRBHOZKW-MUAITKOASA-N |
| XLogP | 2.56 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|