About 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane
3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane (PubChem CID 163580728) has the molecular formula C20H20F4O3
and a molecular weight of 384.37 g/mol. Its IUPAC name is 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane |
| PubChem CID | 163580728 |
| Molecular Formula | C20H20F4O3 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane |
| SMILES | CC(F)c1c(F)cccc1C1OCCO1.CC(F)c1c(F)cccc1C=O |
| InChI | InChI=1S/C11H12F2O2.C9H8F2O/c1-7(12)10-8(3-2-4-9(10)13)11-14-5-6-15-11;1-6(10)9-7(5-12)3-2-4-8(9)11/h2-4,7,11H,5-6H2,1H3;2-6H,1H3 |
| InChIKey | GHIFNZNNDXANPZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane?
The IUPAC name of 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane (CID 163580728) is 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane.
What is the SMILES notation for 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane?
The canonical SMILES for 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane is CC(F)c1c(F)cccc1C1OCCO1.CC(F)c1c(F)cccc1C=O.
What is the InChIKey of 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane?
The InChIKey is GHIFNZNNDXANPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O2.C9H8F2O/c1-7(12)10-8(3-2-4-9(10)13)11-14-5-6-15-11;1-6(10)9-7(5-12)3-2-4-8(9)11/h2-4,7,11H,5-6H2,1H3;2-6H,1H3.
What are the key properties of 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane?
3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane has a molecular weight of 384.37 g/mol, XLogP of 5.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-(1-fluoroethyl)benzaldehyde;2-[3-fluoro-2-(1-fluoroethyl)phenyl]-1,3-dioxolane is sourced from PubChem (CID 163580728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).