C33H35BN3O2+ — CID 163580783
4-phenyl-6-(4-phenylcyclohexa-1,3-dien-1-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-dihydro-1,3,5-triazin-1-ium (PubChem CID 163580783) has the molecular formula C33H35BN3O2+ and a molecular weight of 516.47 g/mol. Its IUPAC name is 4-phenyl-6-(4-phenylcyclohexa-1,3-dien-1-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-dihydro-1,3,5-triazin-1-ium.
| Compound Name | 4-phenyl-6-(4-phenylcyclohexa-1,3-dien-1-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-dihydro-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 163580783 |
| Molecular Formula | C33H35BN3O2+ |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 4-phenyl-6-(4-phenylcyclohexa-1,3-dien-1-yl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-dihydro-1,3,5-triazin-1-ium |
| SMILES | CC1(C)OB(c2ccc(C3N=C(c4ccccc4)N=C(C4=CC=C(c5ccccc5)CC4)[NH2+]3)cc2)OC1(C)C |
| InChI | InChI=1S/C33H34BN3O2/c1-32(2)33(3,4)39-34(38-32)28-21-19-27(20-22-28)31-36-29(25-13-9-6-10-14-25)35-30(37-31)26-17-15-24(16-18-26)23-11-7-5-8-12-23/h5-15,17,19-22,31H,16,18H2,1-4H3,(H,35,36,37)/p+1 |
| InChIKey | GHJAVNHJQXKXIN-UHFFFAOYSA-O |
| XLogP | 5.21 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|