C18H13F4N4O3- — CID 163580854
N-[(5-fluoro-6,7-dihydro-1H-benzimidazol-2-yl)methyl]-2-[2-oxo-5-(trifluoromethyl)-1,3-benzoxazol-3-yl]ethanimidate (PubChem CID 163580854) has the molecular formula C18H13F4N4O3- and a molecular weight of 409.32 g/mol. Its IUPAC name is N-[(5-fluoro-6,7-dihydro-1H-benzimidazol-2-yl)methyl]-2-[2-oxo-5-(trifluoromethyl)-1,3-benzoxazol-3-yl]ethanimidate.
| Compound Name | N-[(5-fluoro-6,7-dihydro-1H-benzimidazol-2-yl)methyl]-2-[2-oxo-5-(trifluoromethyl)-1,3-benzoxazol-3-yl]ethanimidate |
|---|---|
| PubChem CID | 163580854 |
| Molecular Formula | C18H13F4N4O3- |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-[(5-fluoro-6,7-dihydro-1H-benzimidazol-2-yl)methyl]-2-[2-oxo-5-(trifluoromethyl)-1,3-benzoxazol-3-yl]ethanimidate |
| SMILES | O=c1oc2ccc(C(F)(F)F)cc2n1C/C([O-])=N/Cc1nc2c([nH]1)CCC(F)=C2 |
| InChI | InChI=1S/C18H14F4N4O3/c19-10-2-3-11-12(6-10)25-15(24-11)7-23-16(27)8-26-13-5-9(18(20,21)22)1-4-14(13)29-17(26)28/h1,4-6H,2-3,7-8H2,(H,23,27)(H,24,25)/p-1 |
| InChIKey | KFCKINGMQOGFDA-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|