C12H12ClNS — CID 163581067
5-(2-chlorophenyl)-4-ethyl-2-methyl-1,3-thiazole (PubChem CID 163581067) has the molecular formula C12H12ClNS and a molecular weight of 237.76 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-4-ethyl-2-methyl-1,3-thiazole.
| Compound Name | 5-(2-chlorophenyl)-4-ethyl-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 163581067 |
| Molecular Formula | C12H12ClNS |
| Molecular Weight | 237.76 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 5-(2-chlorophenyl)-4-ethyl-2-methyl-1,3-thiazole |
| SMILES | CCc1nc(C)sc1-c1ccccc1Cl |
| InChI | InChI=1S/C12H12ClNS/c1-3-11-12(15-8(2)14-11)9-6-4-5-7-10(9)13/h4-7H,3H2,1-2H3 |
| InChIKey | GHOVVGSKOXWVKP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |