C17H19O5+ — CID 163582112
[3-acetyl-9a-methyl-2-oxo-6-[(E)-prop-1-enyl]-3,3a,4,8-tetrahydrofuro[3,2-g]isochromen-9-ylidene]oxidanium (PubChem CID 163582112) has the molecular formula C17H19O5+ and a molecular weight of 303.33 g/mol. Its IUPAC name is [3-acetyl-9a-methyl-2-oxo-6-[(E)-prop-1-enyl]-3,3a,4,8-tetrahydrofuro[3,2-g]isochromen-9-ylidene]oxidanium.
| Compound Name | [3-acetyl-9a-methyl-2-oxo-6-[(E)-prop-1-enyl]-3,3a,4,8-tetrahydrofuro[3,2-g]isochromen-9-ylidene]oxidanium |
|---|---|
| PubChem CID | 163582112 |
| Molecular Formula | C17H19O5+ |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [3-acetyl-9a-methyl-2-oxo-6-[(E)-prop-1-enyl]-3,3a,4,8-tetrahydrofuro[3,2-g]isochromen-9-ylidene]oxidanium |
| SMILES | [H]/[O+]=C1\C2=C(C=C(/C=C/C)OC2)CC2C(C(C)=O)C(=O)OC12C |
| InChI | InChI=1S/C17H18O5/c1-4-5-11-6-10-7-13-14(9(2)18)16(20)22-17(13,3)15(19)12(10)8-21-11/h4-6,13-14H,7-8H2,1-3H3/p+1/b5-4+ |
| InChIKey | GIKQHOXMDCDAPT-SNAWJCMRSA-O |
| XLogP | 1.86 |
| TPSA | 74.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|