About 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene
7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene (PubChem CID 163582428) has the molecular formula C17H19FS
and a molecular weight of 274.40 g/mol. Its IUPAC name is 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene.
Molecular Properties
| Compound Name | 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene |
| PubChem CID | 163582428 |
| Molecular Formula | C17H19FS |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene |
| SMILES | CC1=C=CC2(c3ccccc3F)CCCCC2CS1 |
| InChI | InChI=1S/C17H19FS/c1-13-9-11-17(15-7-2-3-8-16(15)18)10-5-4-6-14(17)12-19-13/h2-3,7-8,11,14H,4-6,10,12H2,1H3 |
| InChIKey | GIRINEZSRIXIBP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene?
The IUPAC name of 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene (CID 163582428) is 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene.
What is the SMILES notation for 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene?
The canonical SMILES for 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene is CC1=C=CC2(c3ccccc3F)CCCCC2CS1.
What is the InChIKey of 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene?
The InChIKey is GIRINEZSRIXIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FS/c1-13-9-11-17(15-7-2-3-8-16(15)18)10-5-4-6-14(17)12-19-13/h2-3,7-8,11,14H,4-6,10,12H2,1H3.
What are the key properties of 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene?
7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene has a molecular weight of 274.40 g/mol, XLogP of 5.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-fluorophenyl)-4-methyl-3-thiabicyclo[5.4.0]undeca-4,5-diene is sourced from PubChem (CID 163582428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).