C12H11NS — CID 163583215
5-[(E)-2-(3-methylphenyl)ethenyl]-1,3-thiazole (PubChem CID 163583215) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 5-[(E)-2-(3-methylphenyl)ethenyl]-1,3-thiazole.
| Compound Name | 5-[(E)-2-(3-methylphenyl)ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 163583215 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 5-[(E)-2-(3-methylphenyl)ethenyl]-1,3-thiazole |
| SMILES | Cc1cccc(/C=C/c2cncs2)c1 |
| InChI | InChI=1S/C12H11NS/c1-10-3-2-4-11(7-10)5-6-12-8-13-9-14-12/h2-9H,1H3/b6-5+ |
| InChIKey | WKZORXBCZGXPNY-AATRIKPKSA-N |
| XLogP | 3.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |