C43H52O8 — CID 163583423
4,4-bis(2-phenylethoxy)pentanoyloxymethyl 4,4-bis(2-phenylethoxy)pentanoate (PubChem CID 163583423) has the molecular formula C43H52O8 and a molecular weight of 696.88 g/mol. Its IUPAC name is 4,4-bis(2-phenylethoxy)pentanoyloxymethyl 4,4-bis(2-phenylethoxy)pentanoate.
| Compound Name | 4,4-bis(2-phenylethoxy)pentanoyloxymethyl 4,4-bis(2-phenylethoxy)pentanoate |
|---|---|
| PubChem CID | 163583423 |
| Molecular Formula | C43H52O8 |
| Molecular Weight | 696.88 g/mol |
| Exact Mass | 696.37 |
| IUPAC Name | 4,4-bis(2-phenylethoxy)pentanoyloxymethyl 4,4-bis(2-phenylethoxy)pentanoate |
| SMILES | CC(CCC(=O)OCOC(=O)CCC(C)(OCCc1ccccc1)OCCc1ccccc1)(OCCc1ccccc1)OCCc1ccccc1 |
| InChI | InChI=1S/C43H52O8/c1-42(48-31-25-36-15-7-3-8-16-36,49-32-26-37-17-9-4-10-18-37)29-23-40(44)46-35-47-41(45)24-30-43(2,50-33-27-38-19-11-5-12-20-38)51-34-28-39-21-13-6-14-22-39/h3-22H,23-35H2,1-2H3 |
| InChIKey | GJMKRNHDZCOXQX-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.88 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|