About 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol
2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol (PubChem CID 163584107) has the molecular formula C15H17ClO2
and a molecular weight of 264.75 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol |
| PubChem CID | 163584107 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol |
| SMILES | OCCOC1=CCC(Cc2ccc(Cl)cc2)C=C1 |
| InChI | InChI=1S/C15H17ClO2/c16-14-5-1-12(2-6-14)11-13-3-7-15(8-4-13)18-10-9-17/h1-3,5-8,13,17H,4,9-11H2 |
| InChIKey | XNNKIIZRYAVWRB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol?
The IUPAC name of 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol (CID 163584107) is 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol.
What is the SMILES notation for 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol?
The canonical SMILES for 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol is OCCOC1=CCC(Cc2ccc(Cl)cc2)C=C1.
What is the InChIKey of 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol?
The InChIKey is XNNKIIZRYAVWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClO2/c16-14-5-1-12(2-6-14)11-13-3-7-15(8-4-13)18-10-9-17/h1-3,5-8,13,17H,4,9-11H2.
What are the key properties of 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol?
2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol has a molecular weight of 264.75 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-chlorophenyl)methyl]cyclohexa-1,5-dien-1-yl]oxyethanol is sourced from PubChem (CID 163584107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).