C27H32N4O3 — CID 163584639
2-methoxy-N-[2-[4-[3-[5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]propyl]phenoxy]ethyl]ethanamine (PubChem CID 163584639) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-methoxy-N-[2-[4-[3-[5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]propyl]phenoxy]ethyl]ethanamine.
| Compound Name | 2-methoxy-N-[2-[4-[3-[5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]propyl]phenoxy]ethyl]ethanamine |
|---|---|
| PubChem CID | 163584639 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-methoxy-N-[2-[4-[3-[5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]propyl]phenoxy]ethyl]ethanamine |
| SMILES | COCCNCCOc1ccc(CCCc2nc3cccc(-c4ccc(OC)cc4)n3n2)cc1 |
| InChI | InChI=1S/C27H32N4O3/c1-32-19-17-28-18-20-34-24-13-9-21(10-14-24)5-3-7-26-29-27-8-4-6-25(31(27)30-26)22-11-15-23(33-2)16-12-22/h4,6,8-16,28H,3,5,7,17-20H2,1-2H3 |
| InChIKey | GKMFQPJQRGEZGY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|