C18H23N5 — CID 163584990
7-benzyl-2-N-butyl-6-methylidene-5H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 163584990) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 7-benzyl-2-N-butyl-6-methylidene-5H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 7-benzyl-2-N-butyl-6-methylidene-5H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163584990 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 7-benzyl-2-N-butyl-6-methylidene-5H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | C=C1Cc2c(N)nc(NCCCC)nc2N1Cc1ccccc1 |
| InChI | InChI=1S/C18H23N5/c1-3-4-10-20-18-21-16(19)15-11-13(2)23(17(15)22-18)12-14-8-6-5-7-9-14/h5-9H,2-4,10-12H2,1H3,(H3,19,20,21,22) |
| InChIKey | GSYVCCCGFHPXHL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|