About carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium
carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium (PubChem CID 163585350) has the molecular formula C11H11NO2Os-2
and a molecular weight of 379.44 g/mol. Its IUPAC name is carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium.
Molecular Properties
| Compound Name | carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium |
| PubChem CID | 163585350 |
| Molecular Formula | C11H11NO2Os-2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium |
| SMILES | O=[Os].[CH3-].[H]/N=C1\C=[C-]C2C=CC=CC2C1=O |
| InChI | InChI=1S/C10H8NO.CH3.O.Os/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;;;/h1-4,6-8,11H;1H3;;/q2*-1;;/b11-9+;;; |
| InChIKey | IKDWIKVUQCINEX-OOQPXJNPSA-N |
| XLogP | 1.64 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium?
The IUPAC name of carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium (CID 163585350) is carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium.
What is the SMILES notation for carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium?
The canonical SMILES for carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium is O=[Os].[CH3-].[H]/N=C1\C=[C-]C2C=CC=CC2C1=O.
What is the InChIKey of carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium?
The InChIKey is IKDWIKVUQCINEX-OOQPXJNPSA-N. The full InChI is InChI=1S/C10H8NO.CH3.O.Os/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;;;/h1-4,6-8,11H;1H3;;/q2*-1;;/b11-9+;;;.
What are the key properties of carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium?
carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium has a molecular weight of 379.44 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-imino-4a,8a-dihydro-4H-naphthalen-4-id-1-one;oxoosmium is sourced from PubChem (CID 163585350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).