C11H18N2O — CID 163585409
3,6-dimethyl-2-pentan-2-ylpyrimidin-4-one (PubChem CID 163585409) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3,6-dimethyl-2-pentan-2-ylpyrimidin-4-one.
| Compound Name | 3,6-dimethyl-2-pentan-2-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 163585409 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3,6-dimethyl-2-pentan-2-ylpyrimidin-4-one |
| SMILES | CCCC(C)c1nc(C)cc(=O)n1C |
| InChI | InChI=1S/C11H18N2O/c1-5-6-8(2)11-12-9(3)7-10(14)13(11)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | GLBDGYWQLDQRLB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |