C20H19NO2S — CID 163585856
(1Z)-1-(1,8-diethyl-[1]benzofuro[3,2-e][1,3]benzothiazol-2-ylidene)propan-2-one (PubChem CID 163585856) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is (1Z)-1-(1,8-diethyl-[1]benzofuro[3,2-e][1,3]benzothiazol-2-ylidene)propan-2-one.
| Compound Name | (1Z)-1-(1,8-diethyl-[1]benzofuro[3,2-e][1,3]benzothiazol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 163585856 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (1Z)-1-(1,8-diethyl-[1]benzofuro[3,2-e][1,3]benzothiazol-2-ylidene)propan-2-one |
| SMILES | CCc1ccc2c(c1)oc1ccc3c(c12)N(CC)/C(=C/C(C)=O)S3 |
| InChI | InChI=1S/C20H19NO2S/c1-4-13-6-7-14-16(11-13)23-15-8-9-17-20(19(14)15)21(5-2)18(24-17)10-12(3)22/h6-11H,4-5H2,1-3H3/b18-10- |
| InChIKey | GLKDPKOHOWFTMQ-ZDLGFXPLSA-N |
| XLogP | 5.51 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|