About 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane
8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane (PubChem CID 163586230) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane |
| PubChem CID | 163586230 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane |
| SMILES | CN1CCC2(CC1)CNCN2c1ccccc1 |
| InChI | InChI=1S/C14H21N3/c1-16-9-7-14(8-10-16)11-15-12-17(14)13-5-3-2-4-6-13/h2-6,15H,7-12H2,1H3 |
| InChIKey | GLSFCQSESRTPHC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane?
The IUPAC name of 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane (CID 163586230) is 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane.
What is the SMILES notation for 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane?
The canonical SMILES for 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane is CN1CCC2(CC1)CNCN2c1ccccc1.
What is the InChIKey of 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane?
The InChIKey is GLSFCQSESRTPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-16-9-7-14(8-10-16)11-15-12-17(14)13-5-3-2-4-6-13/h2-6,15H,7-12H2,1H3.
What are the key properties of 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane?
8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane has a molecular weight of 231.34 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1-phenyl-1,3,8-triazaspiro[4.5]decane is sourced from PubChem (CID 163586230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).