About 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene
1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene (PubChem CID 163586300) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene.
Molecular Properties
| Compound Name | 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene |
| PubChem CID | 163586300 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene |
| SMILES | C=CC/C=C\C1=C(C)CCC1C |
| InChI | InChI=1S/C12H18/c1-4-5-6-7-12-10(2)8-9-11(12)3/h4,6-7,10H,1,5,8-9H2,2-3H3/b7-6- |
| InChIKey | GLTPVBIUWRXUMH-SREVYHEPSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene?
The IUPAC name of 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene (CID 163586300) is 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene.
What is the SMILES notation for 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene?
The canonical SMILES for 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene is C=CC/C=C\C1=C(C)CCC1C.
What is the InChIKey of 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene?
The InChIKey is GLTPVBIUWRXUMH-SREVYHEPSA-N. The full InChI is InChI=1S/C12H18/c1-4-5-6-7-12-10(2)8-9-11(12)3/h4,6-7,10H,1,5,8-9H2,2-3H3/b7-6-.
What are the key properties of 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene?
1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene has a molecular weight of 162.28 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2-[(1Z)-penta-1,4-dienyl]cyclopentene is sourced from PubChem (CID 163586300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).