About CID 163587332
CID 163587332 (PubChem CID 163587332) has the molecular formula C26H32F6IN4O3-
and a molecular weight of 689.46 g/mol.
Molecular Properties
| Compound Name | CID 163587332 |
| PubChem CID | 163587332 |
| Molecular Formula | C26H32F6IN4O3- |
| Molecular Weight | 689.46 g/mol |
| Exact Mass | 689.14 |
| IUPAC Name | — |
| SMILES | CC1=CCC(C2(O)CCC(N3CC(NC(=O)CNC(=O)c4cc(C(F)(F)F)ccc4C(F)(F)F)C3)CC2)C[I-]N1 |
| InChI | InChI=1S/C26H32F6IN4O3/c1-15-2-3-17(11-33-36-15)24(40)8-6-19(7-9-24)37-13-18(14-37)35-22(38)12-34-23(39)20-10-16(25(27,28)29)4-5-21(20)26(30,31)32/h2,4-5,10,17-19,36,40H,3,6-9,11-14H2,1H3,(H,34,39)(H,35,38)/q-1 |
| InChIKey | QWQKAHPGLOEQIL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 689.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 163587332 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163587332?
The IUPAC name of CID 163587332 (CID 163587332) is not available.
What is the SMILES notation for CID 163587332?
The canonical SMILES for CID 163587332 is CC1=CCC(C2(O)CCC(N3CC(NC(=O)CNC(=O)c4cc(C(F)(F)F)ccc4C(F)(F)F)C3)CC2)C[I-]N1.
What is the InChIKey of CID 163587332?
The InChIKey is QWQKAHPGLOEQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32F6IN4O3/c1-15-2-3-17(11-33-36-15)24(40)8-6-19(7-9-24)37-13-18(14-37)35-22(38)12-34-23(39)20-10-16(25(27,28)29)4-5-21(20)26(30,31)32/h2,4-5,10,17-19,36,40H,3,6-9,11-14H2,1H3,(H,34,39)(H,35,38)/q-1.
What are the key properties of CID 163587332?
CID 163587332 has a molecular weight of 689.46 g/mol, XLogP of 0.45, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163587332 is sourced from PubChem (CID 163587332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).