About CID 163587529
CID 163587529 (PubChem CID 163587529) has the molecular formula C9H10IN2O2-
and a molecular weight of 305.10 g/mol.
Molecular Properties
| Compound Name | CID 163587529 |
| PubChem CID | 163587529 |
| Molecular Formula | C9H10IN2O2- |
| Molecular Weight | 305.10 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | — |
| SMILES | Cc1cc(C2C[I-]2)c([N+](=O)[O-])c(C)n1 |
| InChI | InChI=1S/C9H10IN2O2/c1-5-3-7(8-4-10-8)9(12(13)14)6(2)11-5/h3,8H,4H2,1-2H3/q-1 |
| InChIKey | YGAMLPLPNCHWKO-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.10 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 163587529 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163587529?
The IUPAC name of CID 163587529 (CID 163587529) is not available.
What is the SMILES notation for CID 163587529?
The canonical SMILES for CID 163587529 is Cc1cc(C2C[I-]2)c([N+](=O)[O-])c(C)n1.
What is the InChIKey of CID 163587529?
The InChIKey is YGAMLPLPNCHWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10IN2O2/c1-5-3-7(8-4-10-8)9(12(13)14)6(2)11-5/h3,8H,4H2,1-2H3/q-1.
What are the key properties of CID 163587529?
CID 163587529 has a molecular weight of 305.10 g/mol, XLogP of -1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163587529 is sourced from PubChem (CID 163587529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).