C6H12N2O3 — CID 163587675
(4S,5R,6R)-3,5-diamino-4-hydroxy-6-methyloxan-2-one (PubChem CID 163587675) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is (4S,5R,6R)-3,5-diamino-4-hydroxy-6-methyloxan-2-one.
| Compound Name | (4S,5R,6R)-3,5-diamino-4-hydroxy-6-methyloxan-2-one |
|---|---|
| PubChem CID | 163587675 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | (4S,5R,6R)-3,5-diamino-4-hydroxy-6-methyloxan-2-one |
| SMILES | C[C@H]1OC(=O)C(N)[C@@H](O)[C@H]1N |
| InChI | InChI=1S/C6H12N2O3/c1-2-3(7)5(9)4(8)6(10)11-2/h2-5,9H,7-8H2,1H3/t2-,3+,4?,5+/m1/s1 |
| InChIKey | GMVRYRLIPDXSFD-UOFNXBMGSA-N |
| XLogP | -2.05 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |