C29H23N5O7PS+ — CID 163588623
2-naphthalen-2-ylsulfanyl-6-phenyl-3-(3,3,9-trihydroxy-2,4,7-trioxa-3-phosphoniatricyclo[6.1.1.01,6]decan-8-yl)-5H-imidazo[1,2-a]purin-9-one (PubChem CID 163588623) has the molecular formula C29H23N5O7PS+ and a molecular weight of 616.57 g/mol. Its IUPAC name is 2-naphthalen-2-ylsulfanyl-6-phenyl-3-(3,3,9-trihydroxy-2,4,7-trioxa-3-phosphoniatricyclo[6.1.1.01,6]decan-8-yl)-5H-imidazo[1,2-a]purin-9-one.
| Compound Name | 2-naphthalen-2-ylsulfanyl-6-phenyl-3-(3,3,9-trihydroxy-2,4,7-trioxa-3-phosphoniatricyclo[6.1.1.01,6]decan-8-yl)-5H-imidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 163588623 |
| Molecular Formula | C29H23N5O7PS+ |
| Molecular Weight | 616.57 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | 2-naphthalen-2-ylsulfanyl-6-phenyl-3-(3,3,9-trihydroxy-2,4,7-trioxa-3-phosphoniatricyclo[6.1.1.01,6]decan-8-yl)-5H-imidazo[1,2-a]purin-9-one |
| SMILES | O=c1c2nc(Sc3ccc4ccccc4c3)n(C34CC5(O[P+](O)(O)OCC5O3)C4O)c2nc2[nH]c(-c3ccccc3)cn12 |
| InChI | InChI=1S/C29H22N5O7PS/c35-24-22-23(32-26-30-20(13-33(24)26)17-7-2-1-3-8-17)34(27(31-22)43-19-11-10-16-6-4-5-9-18(16)12-19)29-15-28(25(29)36)21(40-29)14-39-42(37,38)41-28/h1-13,21,25,36-38H,14-15H2/p+1 |
| InChIKey | XKTWAFNCHIOUEL-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|