About 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione
5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione (PubChem CID 163589367) has the molecular formula C17H10N2O6
and a molecular weight of 338.28 g/mol. Its IUPAC name is 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione |
| PubChem CID | 163589367 |
| Molecular Formula | C17H10N2O6 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione |
| SMILES | NC(N)(c1ccc2c(c1)C(=O)OC2=O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C17H10N2O6/c18-17(19,7-1-3-9-11(5-7)15(22)24-13(9)20)8-2-4-10-12(6-8)16(23)25-14(10)21/h1-6H,18-19H2 |
| InChIKey | GOEZKGDPLNZDMB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione?
The IUPAC name of 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione (CID 163589367) is 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione.
What is the SMILES notation for 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione?
The canonical SMILES for 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione is NC(N)(c1ccc2c(c1)C(=O)OC2=O)c1ccc2c(c1)C(=O)OC2=O.
What is the InChIKey of 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione?
The InChIKey is GOEZKGDPLNZDMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2O6/c18-17(19,7-1-3-9-11(5-7)15(22)24-13(9)20)8-2-4-10-12(6-8)16(23)25-14(10)21/h1-6H,18-19H2.
What are the key properties of 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione?
5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione has a molecular weight of 338.28 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[diamino-(1,3-dioxo-2-benzofuran-5-yl)methyl]-2-benzofuran-1,3-dione is sourced from PubChem (CID 163589367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).