About 1-butan-2-ylazirine;zinc
1-butan-2-ylazirine;zinc (PubChem CID 163589614) has the molecular formula C6H10NZn-
and a molecular weight of 161.54 g/mol. Its IUPAC name is 1-butan-2-ylazirine;zinc.
Molecular Properties
| Compound Name | 1-butan-2-ylazirine;zinc |
| PubChem CID | 163589614 |
| Molecular Formula | C6H10NZn- |
| Molecular Weight | 161.54 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 1-butan-2-ylazirine;zinc |
| SMILES | [CH2-]CC(C)N1C=C1.[Zn] |
| InChI | InChI=1S/C6H10N.Zn/c1-3-6(2)7-4-5-7;/h4-6H,1,3H2,2H3;/q-1; |
| InChIKey | UMLOIFPNXWJBEW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.54 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-ylazirine;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-ylazirine;zinc?
The IUPAC name of 1-butan-2-ylazirine;zinc (CID 163589614) is 1-butan-2-ylazirine;zinc.
What is the SMILES notation for 1-butan-2-ylazirine;zinc?
The canonical SMILES for 1-butan-2-ylazirine;zinc is [CH2-]CC(C)N1C=C1.[Zn].
What is the InChIKey of 1-butan-2-ylazirine;zinc?
The InChIKey is UMLOIFPNXWJBEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N.Zn/c1-3-6(2)7-4-5-7;/h4-6H,1,3H2,2H3;/q-1;.
What are the key properties of 1-butan-2-ylazirine;zinc?
1-butan-2-ylazirine;zinc has a molecular weight of 161.54 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-ylazirine;zinc is sourced from PubChem (CID 163589614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).