About 1-butan-2-ylazirine
1-butan-2-ylazirine (PubChem CID 163589615) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is 1-butan-2-ylazirine.
Molecular Properties
| Compound Name | 1-butan-2-ylazirine |
| PubChem CID | 163589615 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 1-butan-2-ylazirine |
| SMILES | CCC(C)N1C=C1 |
| InChI | InChI=1S/C6H11N/c1-3-6(2)7-4-5-7/h4-6H,3H2,1-2H3 |
| InChIKey | MTYOICDEMXOCGN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butan-2-ylazirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-ylazirine?
The IUPAC name of 1-butan-2-ylazirine (CID 163589615) is 1-butan-2-ylazirine.
What is the SMILES notation for 1-butan-2-ylazirine?
The canonical SMILES for 1-butan-2-ylazirine is CCC(C)N1C=C1.
What is the InChIKey of 1-butan-2-ylazirine?
The InChIKey is MTYOICDEMXOCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-3-6(2)7-4-5-7/h4-6H,3H2,1-2H3.
What are the key properties of 1-butan-2-ylazirine?
1-butan-2-ylazirine has a molecular weight of 97.16 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-ylazirine is sourced from PubChem (CID 163589615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).