C26H24Cl2F2N4O2S — CID 163590283
2-chloro-N-[2-chloro-3-[5-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]sulfanylphenyl]-4,5-difluorobenzamide (PubChem CID 163590283) has the molecular formula C26H24Cl2F2N4O2S and a molecular weight of 565.47 g/mol. Its IUPAC name is 2-chloro-N-[2-chloro-3-[5-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]sulfanylphenyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[2-chloro-3-[5-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]sulfanylphenyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 163590283 |
| Molecular Formula | C26H24Cl2F2N4O2S |
| Molecular Weight | 565.47 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 2-chloro-N-[2-chloro-3-[5-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]sulfanylphenyl]-4,5-difluorobenzamide |
| SMILES | C[C@H]1CC2(CCN(c3cnc(Sc4cccc(NC(=O)c5cc(F)c(F)cc5Cl)c4Cl)cn3)CC2)CO1 |
| InChI | InChI=1S/C26H24Cl2F2N4O2S/c1-15-11-26(14-36-15)5-7-34(8-6-26)22-12-32-23(13-31-22)37-21-4-2-3-20(24(21)28)33-25(35)16-9-18(29)19(30)10-17(16)27/h2-4,9-10,12-13,15H,5-8,11,14H2,1H3,(H,33,35)/t15-/m0/s1 |
| InChIKey | GOYQSXKYPQCNJW-HNNXBMFYSA-N |
| XLogP | 6.86 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.47 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|