C20H24O2S — CID 163590389
[(10R)-6-sulfanyl-1-tetracyclo[6.3.1.03,10.05,10]dodecanyl] 4-methylbenzoate (PubChem CID 163590389) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is [(10R)-6-sulfanyl-1-tetracyclo[6.3.1.03,10.05,10]dodecanyl] 4-methylbenzoate.
| Compound Name | [(10R)-6-sulfanyl-1-tetracyclo[6.3.1.03,10.05,10]dodecanyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 163590389 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [(10R)-6-sulfanyl-1-tetracyclo[6.3.1.03,10.05,10]dodecanyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC23CC4CC(S)C5CC(C2)[C@@]5(C4)C3)cc1 |
| InChI | InChI=1S/C20H24O2S/c1-12-2-4-14(5-3-12)18(21)22-19-8-13-6-17(23)16-7-15(10-19)20(16,9-13)11-19/h2-5,13,15-17,23H,6-11H2,1H3/t13?,15?,16?,17?,19?,20-/m1/s1 |
| InChIKey | GPBFPIDYNXDXGS-UGNINOHGSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|