C15H20FN — CID 163590444
(3Z,6Z,8Z)-6-ethenyl-9-fluoro-N,10-dimethylundeca-3,6,8,10-tetraen-5-imine (PubChem CID 163590444) has the molecular formula C15H20FN and a molecular weight of 233.33 g/mol. Its IUPAC name is (3Z,6Z,8Z)-6-ethenyl-9-fluoro-N,10-dimethylundeca-3,6,8,10-tetraen-5-imine.
| Compound Name | (3Z,6Z,8Z)-6-ethenyl-9-fluoro-N,10-dimethylundeca-3,6,8,10-tetraen-5-imine |
|---|---|
| PubChem CID | 163590444 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (3Z,6Z,8Z)-6-ethenyl-9-fluoro-N,10-dimethylundeca-3,6,8,10-tetraen-5-imine |
| SMILES | C=CC(=C/C=C(\F)C(=C)C)/C(/C=C\CC)=N/C |
| InChI | InChI=1S/C15H20FN/c1-6-8-9-15(17-5)13(7-2)10-11-14(16)12(3)4/h7-11H,2-3,6H2,1,4-5H3/b9-8-,13-10-,14-11-,17-15+ |
| InChIKey | GPCONZCIFJIOMM-ZFWNKZJESA-N |
| XLogP | 4.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|