C9H14F3N3 — CID 163590707
N-tert-butyl-1-methyl-3-(trifluoromethyl)pyrazol-5-amine (PubChem CID 163590707) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is N-tert-butyl-1-methyl-3-(trifluoromethyl)pyrazol-5-amine.
| Compound Name | N-tert-butyl-1-methyl-3-(trifluoromethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 163590707 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-tert-butyl-1-methyl-3-(trifluoromethyl)pyrazol-5-amine |
| SMILES | Cn1nc(C(F)(F)F)cc1NC(C)(C)C |
| InChI | InChI=1S/C9H14F3N3/c1-8(2,3)13-7-5-6(9(10,11)12)14-15(7)4/h5,13H,1-4H3 |
| InChIKey | GPHOZWLRQGDKCH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |