About 4-bromo-8-phenyl-8,8a-dihydroquinazoline
4-bromo-8-phenyl-8,8a-dihydroquinazoline (PubChem CID 163590970) has the molecular formula C14H11BrN2
and a molecular weight of 287.16 g/mol. Its IUPAC name is 4-bromo-8-phenyl-8,8a-dihydroquinazoline.
Molecular Properties
| Compound Name | 4-bromo-8-phenyl-8,8a-dihydroquinazoline |
| PubChem CID | 163590970 |
| Molecular Formula | C14H11BrN2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 4-bromo-8-phenyl-8,8a-dihydroquinazoline |
| SMILES | BrC1=NC=NC2C1=CC=CC2c1ccccc1 |
| InChI | InChI=1S/C14H11BrN2/c15-14-12-8-4-7-11(13(12)16-9-17-14)10-5-2-1-3-6-10/h1-9,11,13H |
| InChIKey | GPMUATUJQSBXTB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-8-phenyl-8,8a-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-8-phenyl-8,8a-dihydroquinazoline?
The IUPAC name of 4-bromo-8-phenyl-8,8a-dihydroquinazoline (CID 163590970) is 4-bromo-8-phenyl-8,8a-dihydroquinazoline.
What is the SMILES notation for 4-bromo-8-phenyl-8,8a-dihydroquinazoline?
The canonical SMILES for 4-bromo-8-phenyl-8,8a-dihydroquinazoline is BrC1=NC=NC2C1=CC=CC2c1ccccc1.
What is the InChIKey of 4-bromo-8-phenyl-8,8a-dihydroquinazoline?
The InChIKey is GPMUATUJQSBXTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN2/c15-14-12-8-4-7-11(13(12)16-9-17-14)10-5-2-1-3-6-10/h1-9,11,13H.
What are the key properties of 4-bromo-8-phenyl-8,8a-dihydroquinazoline?
4-bromo-8-phenyl-8,8a-dihydroquinazoline has a molecular weight of 287.16 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-8-phenyl-8,8a-dihydroquinazoline is sourced from PubChem (CID 163590970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).