C17H28F4O5S — CID 163591391
[1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] 2-methylpropanoate (PubChem CID 163591391) has the molecular formula C17H28F4O5S and a molecular weight of 420.47 g/mol. Its IUPAC name is [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] 2-methylpropanoate.
| Compound Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163591391 |
| Molecular Formula | C17H28F4O5S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(COCCC1CCS(=O)(=O)CC1)C(F)(F)CC(C)(F)F |
| InChI | InChI=1S/C17H28F4O5S/c1-12(2)15(22)26-14(17(20,21)11-16(3,18)19)10-25-7-4-13-5-8-27(23,24)9-6-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | FFNWFWAROYDDIG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|