C18H30F4O5S — CID 163591392
[1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] 2,2-dimethylpropanoate (PubChem CID 163591392) has the molecular formula C18H30F4O5S and a molecular weight of 434.49 g/mol. Its IUPAC name is [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163591392 |
| Molecular Formula | C18H30F4O5S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(F)(F)CC(F)(F)C(COCCC1CCS(=O)(=O)CC1)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H30F4O5S/c1-16(2,3)15(23)27-14(18(21,22)12-17(4,19)20)11-26-8-5-13-6-9-28(24,25)10-7-13/h13-14H,5-12H2,1-4H3 |
| InChIKey | DOESRLRXKJXFQH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|