C20H32F4O5S — CID 163591393
[1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] cyclohexanecarboxylate (PubChem CID 163591393) has the molecular formula C20H32F4O5S and a molecular weight of 460.53 g/mol. Its IUPAC name is [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] cyclohexanecarboxylate.
| Compound Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 163591393 |
| Molecular Formula | C20H32F4O5S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5-tetrafluorohexan-2-yl] cyclohexanecarboxylate |
| SMILES | CC(F)(F)CC(F)(F)C(COCCC1CCS(=O)(=O)CC1)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H32F4O5S/c1-19(21,22)14-20(23,24)17(29-18(25)16-5-3-2-4-6-16)13-28-10-7-15-8-11-30(26,27)12-9-15/h15-17H,2-14H2,1H3 |
| InChIKey | FOUAUPDGZXGNLW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|