About 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal
4-cyclopenta-1,3-dien-1-yl-4-iminobutanal (PubChem CID 163591561) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal.
Molecular Properties
| Compound Name | 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal |
| PubChem CID | 163591561 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal |
| SMILES | [H]/N=C(\CCC=O)C1=CC=CC1 |
| InChI | InChI=1S/C9H11NO/c10-9(6-3-7-11)8-4-1-2-5-8/h1-2,4,7,10H,3,5-6H2/b10-9+ |
| InChIKey | GPYCAYHRMSJDGI-MDZDMXLPSA-N |
| XLogP | 1.87 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal?
The IUPAC name of 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal (CID 163591561) is 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal.
What is the SMILES notation for 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal?
The canonical SMILES for 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal is [H]/N=C(\CCC=O)C1=CC=CC1.
What is the InChIKey of 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal?
The InChIKey is GPYCAYHRMSJDGI-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H11NO/c10-9(6-3-7-11)8-4-1-2-5-8/h1-2,4,7,10H,3,5-6H2/b10-9+.
What are the key properties of 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal?
4-cyclopenta-1,3-dien-1-yl-4-iminobutanal has a molecular weight of 149.19 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopenta-1,3-dien-1-yl-4-iminobutanal is sourced from PubChem (CID 163591561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).