C13H15N2S+ — CID 163591878
10-ethyl-5,11-dimethyl-3-thia-9-aza-11-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaene (PubChem CID 163591878) has the molecular formula C13H15N2S+ and a molecular weight of 231.34 g/mol. Its IUPAC name is 10-ethyl-5,11-dimethyl-3-thia-9-aza-11-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaene.
| Compound Name | 10-ethyl-5,11-dimethyl-3-thia-9-aza-11-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaene |
|---|---|
| PubChem CID | 163591878 |
| Molecular Formula | C13H15N2S+ |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 10-ethyl-5,11-dimethyl-3-thia-9-aza-11-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaene |
| SMILES | CCc1n2ccc3c(C)csc3c2c[n+]1C |
| InChI | InChI=1S/C13H15N2S/c1-4-12-14(3)7-11-13-10(5-6-15(11)12)9(2)8-16-13/h5-8H,4H2,1-3H3/q+1 |
| InChIKey | GNTOTPPKCJRVEN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|