About [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate
[(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate (PubChem CID 163591932) has the molecular formula C6H11N3O6
and a molecular weight of 221.17 g/mol. Its IUPAC name is [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate.
Molecular Properties
| Compound Name | [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate |
| PubChem CID | 163591932 |
| Molecular Formula | C6H11N3O6 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate |
| SMILES | COC(OC(N)=O)[C@H](OC(N)=O)C(N)=O |
| InChI | InChI=1S/C6H11N3O6/c1-13-4(15-6(9)12)2(3(7)10)14-5(8)11/h2,4H,1H3,(H2,7,10)(H2,8,11)(H2,9,12)/t2-,4?/m1/s1 |
| InChIKey | GQFGHIIQMVJVOM-DPAZEOEGSA-N |
| XLogP | -2.00 |
| TPSA | 156.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate?
The IUPAC name of [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate (CID 163591932) is [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate.
What is the SMILES notation for [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate?
The canonical SMILES for [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate is COC(OC(N)=O)[C@H](OC(N)=O)C(N)=O.
What is the InChIKey of [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate?
The InChIKey is GQFGHIIQMVJVOM-DPAZEOEGSA-N. The full InChI is InChI=1S/C6H11N3O6/c1-13-4(15-6(9)12)2(3(7)10)14-5(8)11/h2,4H,1H3,(H2,7,10)(H2,8,11)(H2,9,12)/t2-,4?/m1/s1.
What are the key properties of [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate?
[(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate has a molecular weight of 221.17 g/mol, XLogP of -2.00, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-1-amino-3-carbamoyloxy-3-methoxy-1-oxopropan-2-yl] carbamate is sourced from PubChem (CID 163591932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).