C8H16I2N6 — CID 163591995
4-N-iodo-6-N-(6-iodohexyl)-1,2,3,5-tetrazinane-4,6-diimine (PubChem CID 163591995) has the molecular formula C8H16I2N6 and a molecular weight of 450.07 g/mol. Its IUPAC name is 4-N-iodo-6-N-(6-iodohexyl)-1,2,3,5-tetrazinane-4,6-diimine.
| Compound Name | 4-N-iodo-6-N-(6-iodohexyl)-1,2,3,5-tetrazinane-4,6-diimine |
|---|---|
| PubChem CID | 163591995 |
| Molecular Formula | C8H16I2N6 |
| Molecular Weight | 450.07 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | 4-N-iodo-6-N-(6-iodohexyl)-1,2,3,5-tetrazinane-4,6-diimine |
| SMILES | ICCCCCC/N=C1/NNNC(=NI)N1 |
| InChI | InChI=1S/C8H16I2N6/c9-5-3-1-2-4-6-11-7-12-8(13-10)15-16-14-7/h16H,1-6H2,(H3,11,12,13,14,15) |
| InChIKey | GQGRKJVZDZIBNS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.07 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|