About 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene
2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene (PubChem CID 163593505) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
Molecular Properties
| Compound Name | 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| PubChem CID | 163593505 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| SMILES | C=CC(=C)Oc1cc2ccc1o2 |
| InChI | InChI=1S/C10H8O2/c1-3-7(2)11-10-6-8-4-5-9(10)12-8/h3-6H,1-2H2 |
| InChIKey | GRMWKFBEHUEEGN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The IUPAC name of 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene (CID 163593505) is 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
What is the SMILES notation for 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The canonical SMILES for 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene is C=CC(=C)Oc1cc2ccc1o2.
What is the InChIKey of 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The InChIKey is GRMWKFBEHUEEGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2/c1-3-7(2)11-10-6-8-4-5-9(10)12-8/h3-6H,1-2H2.
What are the key properties of 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene has a molecular weight of 160.17 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,3-dien-2-yloxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene is sourced from PubChem (CID 163593505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).