C14H18O6 — CID 163594095
1-O-ethyl 3-O-methyl 2-(3-acetylcyclohexa-1,3-dien-1-yl)oxypropanedioate (PubChem CID 163594095) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl 2-(3-acetylcyclohexa-1,3-dien-1-yl)oxypropanedioate.
| Compound Name | 1-O-ethyl 3-O-methyl 2-(3-acetylcyclohexa-1,3-dien-1-yl)oxypropanedioate |
|---|---|
| PubChem CID | 163594095 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-O-ethyl 3-O-methyl 2-(3-acetylcyclohexa-1,3-dien-1-yl)oxypropanedioate |
| SMILES | CCOC(=O)C(OC1=CC(C(C)=O)=CCC1)C(=O)OC |
| InChI | InChI=1S/C14H18O6/c1-4-19-14(17)12(13(16)18-3)20-11-7-5-6-10(8-11)9(2)15/h6,8,12H,4-5,7H2,1-3H3 |
| InChIKey | GRYBAUPCHAQIKS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|